C20H19ClN2O4 — CID 30132938
N-(5-chloro-2-methoxyphenyl)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide (PubChem CID 30132938) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 30132938 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2cc(Cl)ccc2OC)c(=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C20H19ClN2O4/c1-4-23-11-15(19(24)14-10-13(26-2)6-7-17(14)23)20(25)22-16-9-12(21)5-8-18(16)27-3/h5-11H,4H2,1-3H3,(H,22,25) |
| InChIKey | PPVGOTRUIMUSLS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |