About 2-fluorobutane
2-fluorobutane (PubChem CID 3013860) has the molecular formula C4H9F
and a molecular weight of 76.11 g/mol. Its IUPAC name is 2-fluorobutane.
Molecular Properties
| Compound Name | 2-fluorobutane |
| PubChem CID | 3013860 |
| Molecular Formula | C4H9F |
| Molecular Weight | 76.11 g/mol |
| Exact Mass | 76.07 |
| IUPAC Name | 2-fluorobutane |
| SMILES | CCC(C)F |
| InChI | InChI=1S/C4H9F/c1-3-4(2)5/h4H,3H2,1-2H3 |
| InChIKey | IXHWZHXLJJPXIS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.11 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobutane?
The IUPAC name of 2-fluorobutane (CID 3013860) is 2-fluorobutane.
What is the SMILES notation for 2-fluorobutane?
The canonical SMILES for 2-fluorobutane is CCC(C)F.
What is the InChIKey of 2-fluorobutane?
The InChIKey is IXHWZHXLJJPXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F/c1-3-4(2)5/h4H,3H2,1-2H3.
What are the key properties of 2-fluorobutane?
2-fluorobutane has a molecular weight of 76.11 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobutane is sourced from PubChem (CID 3013860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).