About 2-methyl-2,4,6-tris(trifluoromethyl)pyran
2-methyl-2,4,6-tris(trifluoromethyl)pyran (PubChem CID 3013867) has the molecular formula C9H5F9O
and a molecular weight of 300.12 g/mol. Its IUPAC name is 2-methyl-2,4,6-tris(trifluoromethyl)pyran.
Molecular Properties
| Compound Name | 2-methyl-2,4,6-tris(trifluoromethyl)pyran |
| PubChem CID | 3013867 |
| Molecular Formula | C9H5F9O |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-methyl-2,4,6-tris(trifluoromethyl)pyran |
| SMILES | CC1(C(F)(F)F)C=C(C(F)(F)F)C=C(C(F)(F)F)O1 |
| InChI | InChI=1S/C9H5F9O/c1-6(9(16,17)18)3-4(7(10,11)12)2-5(19-6)8(13,14)15/h2-3H,1H3 |
| InChIKey | AWCLMRSGMJWGGT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-2,4,6-tris(trifluoromethyl)pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,4,6-tris(trifluoromethyl)pyran?
The IUPAC name of 2-methyl-2,4,6-tris(trifluoromethyl)pyran (CID 3013867) is 2-methyl-2,4,6-tris(trifluoromethyl)pyran.
What is the SMILES notation for 2-methyl-2,4,6-tris(trifluoromethyl)pyran?
The canonical SMILES for 2-methyl-2,4,6-tris(trifluoromethyl)pyran is CC1(C(F)(F)F)C=C(C(F)(F)F)C=C(C(F)(F)F)O1.
What is the InChIKey of 2-methyl-2,4,6-tris(trifluoromethyl)pyran?
The InChIKey is AWCLMRSGMJWGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F9O/c1-6(9(16,17)18)3-4(7(10,11)12)2-5(19-6)8(13,14)15/h2-3H,1H3.
What are the key properties of 2-methyl-2,4,6-tris(trifluoromethyl)pyran?
2-methyl-2,4,6-tris(trifluoromethyl)pyran has a molecular weight of 300.12 g/mol, XLogP of 4.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,4,6-tris(trifluoromethyl)pyran is sourced from PubChem (CID 3013867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).