About 3-ethenylphenol
3-ethenylphenol (PubChem CID 3013921) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3-ethenylphenol.
Molecular Properties
| Compound Name | 3-ethenylphenol |
| PubChem CID | 3013921 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 3-ethenylphenol |
| SMILES | C=Cc1cccc(O)c1 |
| InChI | InChI=1S/C8H8O/c1-2-7-4-3-5-8(9)6-7/h2-6,9H,1H2 |
| InChIKey | YNGIFMKMDRDNBQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylphenol?
The IUPAC name of 3-ethenylphenol (CID 3013921) is 3-ethenylphenol.
What is the SMILES notation for 3-ethenylphenol?
The canonical SMILES for 3-ethenylphenol is C=Cc1cccc(O)c1.
What is the InChIKey of 3-ethenylphenol?
The InChIKey is YNGIFMKMDRDNBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-2-7-4-3-5-8(9)6-7/h2-6,9H,1H2.
What are the key properties of 3-ethenylphenol?
3-ethenylphenol has a molecular weight of 120.15 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylphenol is sourced from PubChem (CID 3013921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).