About 3-chlorophenanthrene
3-chlorophenanthrene (PubChem CID 3013936) has the molecular formula C14H9Cl
and a molecular weight of 212.68 g/mol. Its IUPAC name is 3-chlorophenanthrene.
Molecular Properties
| Compound Name | 3-chlorophenanthrene |
| PubChem CID | 3013936 |
| Molecular Formula | C14H9Cl |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-chlorophenanthrene |
| SMILES | Clc1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/C14H9Cl/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9H |
| InChIKey | BVFJTESUEYBUOL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorophenanthrene?
The IUPAC name of 3-chlorophenanthrene (CID 3013936) is 3-chlorophenanthrene.
What is the SMILES notation for 3-chlorophenanthrene?
The canonical SMILES for 3-chlorophenanthrene is Clc1ccc2ccc3ccccc3c2c1.
What is the InChIKey of 3-chlorophenanthrene?
The InChIKey is BVFJTESUEYBUOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9H.
What are the key properties of 3-chlorophenanthrene?
3-chlorophenanthrene has a molecular weight of 212.68 g/mol, XLogP of 4.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorophenanthrene is sourced from PubChem (CID 3013936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).