C20H23N3O2 — CID 30139419
1-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]naphthalen-2-ol (PubChem CID 30139419) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]naphthalen-2-ol.
| Compound Name | 1-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 30139419 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]naphthalen-2-ol |
| SMILES | Cc1cc(CN2CCN(Cc3c(O)ccc4ccccc34)CC2)on1 |
| InChI | InChI=1S/C20H23N3O2/c1-15-12-17(25-21-15)13-22-8-10-23(11-9-22)14-19-18-5-3-2-4-16(18)6-7-20(19)24/h2-7,12,24H,8-11,13-14H2,1H3 |
| InChIKey | QXIHPEOMMDLWSL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|