About 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid
2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid (PubChem CID 3013978) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid.
Analyze 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid?
The IUPAC name of 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid (CID 3013978) is 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid.
What is the SMILES notation for 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid?
The canonical SMILES for 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid is O=C(O)c1nc(=O)[nH]c2c1CCCC2.
What is the InChIKey of 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid?
The InChIKey is STARWXDKVTUOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c12-8(13)7-5-3-1-2-4-6(5)10-9(14)11-7/h1-4H2,(H,12,13)(H,10,11,14).
What are the key properties of 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid?
2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-5,6,7,8-tetrahydro-1H-quinazoline-4-carboxylic acid is sourced from PubChem (CID 3013978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).