About 4-methylheptane-3,5-dione
4-methylheptane-3,5-dione (PubChem CID 3013982) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-methylheptane-3,5-dione.
Molecular Properties
| Compound Name | 4-methylheptane-3,5-dione |
| PubChem CID | 3013982 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 4-methylheptane-3,5-dione |
| SMILES | CCC(=O)C(C)C(=O)CC |
| InChI | InChI=1S/C8H14O2/c1-4-7(9)6(3)8(10)5-2/h6H,4-5H2,1-3H3 |
| InChIKey | FIJLPSJMPXGRJL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptane-3,5-dione?
The IUPAC name of 4-methylheptane-3,5-dione (CID 3013982) is 4-methylheptane-3,5-dione.
What is the SMILES notation for 4-methylheptane-3,5-dione?
The canonical SMILES for 4-methylheptane-3,5-dione is CCC(=O)C(C)C(=O)CC.
What is the InChIKey of 4-methylheptane-3,5-dione?
The InChIKey is FIJLPSJMPXGRJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-4-7(9)6(3)8(10)5-2/h6H,4-5H2,1-3H3.
What are the key properties of 4-methylheptane-3,5-dione?
4-methylheptane-3,5-dione has a molecular weight of 142.20 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptane-3,5-dione is sourced from PubChem (CID 3013982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).