About 1-ethenylsulfanylethanol
1-ethenylsulfanylethanol (PubChem CID 3014169) has the molecular formula C4H8OS
and a molecular weight of 104.17 g/mol. Its IUPAC name is 1-ethenylsulfanylethanol.
Molecular Properties
| Compound Name | 1-ethenylsulfanylethanol |
| PubChem CID | 3014169 |
| Molecular Formula | C4H8OS |
| Molecular Weight | 104.17 g/mol |
| Exact Mass | 104.03 |
| IUPAC Name | 1-ethenylsulfanylethanol |
| SMILES | C=CSC(C)O |
| InChI | InChI=1S/C4H8OS/c1-3-6-4(2)5/h3-5H,1H2,2H3 |
| InChIKey | XBSXOHLQFBHTPM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylsulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylsulfanylethanol?
The IUPAC name of 1-ethenylsulfanylethanol (CID 3014169) is 1-ethenylsulfanylethanol.
What is the SMILES notation for 1-ethenylsulfanylethanol?
The canonical SMILES for 1-ethenylsulfanylethanol is C=CSC(C)O.
What is the InChIKey of 1-ethenylsulfanylethanol?
The InChIKey is XBSXOHLQFBHTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8OS/c1-3-6-4(2)5/h3-5H,1H2,2H3.
What are the key properties of 1-ethenylsulfanylethanol?
1-ethenylsulfanylethanol has a molecular weight of 104.17 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylsulfanylethanol is sourced from PubChem (CID 3014169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).