piperazine;sulfuric acid

C4H12N2O4S — CID 3014216

IUPACpiperazine;sulfuric acid
SMILESC1CNCCN1.O=S(=O)(O)O
InChIInChI=1S/C4H10N2.H2O4S/c1-2-6-4-3-5-1;1-5(2,3)4/h5-6H,1-4H2;(H2,1,2,3,4)
InChIKeyMYNIYCGOBKAQAO-UHFFFAOYSA-N
MW184.22 g/mol
LogP-1.47
Rot. Bonds

About piperazine;sulfuric acid

piperazine;sulfuric acid (PubChem CID 3014216) has the molecular formula C4H12N2O4S and a molecular weight of 184.22 g/mol. Its IUPAC name is piperazine;sulfuric acid.

Molecular Properties

Compound Namepiperazine;sulfuric acid
PubChem CID3014216
Molecular FormulaC4H12N2O4S
Molecular Weight184.22 g/mol
Exact Mass184.05
IUPAC Namepiperazine;sulfuric acid
SMILESC1CNCCN1.O=S(=O)(O)O
InChIInChI=1S/C4H10N2.H2O4S/c1-2-6-4-3-5-1;1-5(2,3)4/h5-6H,1-4H2;(H2,1,2,3,4)
InChIKeyMYNIYCGOBKAQAO-UHFFFAOYSA-N
XLogP-1.47
TPSA98.66 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.22
LogP ≤ 5-1.47
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze piperazine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperazine;sulfuric acid?
The IUPAC name of piperazine;sulfuric acid (CID 3014216) is piperazine;sulfuric acid.
What is the SMILES notation for piperazine;sulfuric acid?
The canonical SMILES for piperazine;sulfuric acid is C1CNCCN1.O=S(=O)(O)O.
What is the InChIKey of piperazine;sulfuric acid?
The InChIKey is MYNIYCGOBKAQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.H2O4S/c1-2-6-4-3-5-1;1-5(2,3)4/h5-6H,1-4H2;(H2,1,2,3,4).
What are the key properties of piperazine;sulfuric acid?
piperazine;sulfuric acid has a molecular weight of 184.22 g/mol, XLogP of -1.47, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;sulfuric acid is sourced from PubChem (CID 3014216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).