About 4-phenylmorpholine;hydrochloride
4-phenylmorpholine;hydrochloride (PubChem CID 3014252) has the molecular formula C10H14ClNO
and a molecular weight of 199.68 g/mol. Its IUPAC name is 4-phenylmorpholine;hydrochloride.
Molecular Properties
| Compound Name | 4-phenylmorpholine;hydrochloride |
| PubChem CID | 3014252 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-phenylmorpholine;hydrochloride |
| SMILES | Cl.c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C10H13NO.ClH/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;/h1-5H,6-9H2;1H |
| InChIKey | OJTANAMJGXNZOK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylmorpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmorpholine;hydrochloride?
The IUPAC name of 4-phenylmorpholine;hydrochloride (CID 3014252) is 4-phenylmorpholine;hydrochloride.
What is the SMILES notation for 4-phenylmorpholine;hydrochloride?
The canonical SMILES for 4-phenylmorpholine;hydrochloride is Cl.c1ccc(N2CCOCC2)cc1.
What is the InChIKey of 4-phenylmorpholine;hydrochloride?
The InChIKey is OJTANAMJGXNZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.ClH/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;/h1-5H,6-9H2;1H.
What are the key properties of 4-phenylmorpholine;hydrochloride?
4-phenylmorpholine;hydrochloride has a molecular weight of 199.68 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmorpholine;hydrochloride is sourced from PubChem (CID 3014252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).