About pyrene-1-carbonitrile
pyrene-1-carbonitrile (PubChem CID 3014262) has the molecular formula C17H9N
and a molecular weight of 227.27 g/mol. Its IUPAC name is pyrene-1-carbonitrile.
Molecular Properties
| Compound Name | pyrene-1-carbonitrile |
| PubChem CID | 3014262 |
| Molecular Formula | C17H9N |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | pyrene-1-carbonitrile |
| SMILES | N#Cc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C17H9N/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H |
| InChIKey | LLSYZMNMWXDYMT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene-1-carbonitrile?
The IUPAC name of pyrene-1-carbonitrile (CID 3014262) is pyrene-1-carbonitrile.
What is the SMILES notation for pyrene-1-carbonitrile?
The canonical SMILES for pyrene-1-carbonitrile is N#Cc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of pyrene-1-carbonitrile?
The InChIKey is LLSYZMNMWXDYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9N/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H.
What are the key properties of pyrene-1-carbonitrile?
pyrene-1-carbonitrile has a molecular weight of 227.27 g/mol, XLogP of 4.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene-1-carbonitrile is sourced from PubChem (CID 3014262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).