About 5,6,8-trifluoroquinoline
5,6,8-trifluoroquinoline (PubChem CID 3014355) has the molecular formula C9H4F3N
and a molecular weight of 183.13 g/mol. Its IUPAC name is 5,6,8-trifluoroquinoline.
Molecular Properties
| Compound Name | 5,6,8-trifluoroquinoline |
| PubChem CID | 3014355 |
| Molecular Formula | C9H4F3N |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 5,6,8-trifluoroquinoline |
| SMILES | Fc1cc(F)c2ncccc2c1F |
| InChI | InChI=1S/C9H4F3N/c10-6-4-7(11)9-5(8(6)12)2-1-3-13-9/h1-4H |
| InChIKey | DFYPWUZXTWLPSC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5,6,8-trifluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,8-trifluoroquinoline?
The IUPAC name of 5,6,8-trifluoroquinoline (CID 3014355) is 5,6,8-trifluoroquinoline.
What is the SMILES notation for 5,6,8-trifluoroquinoline?
The canonical SMILES for 5,6,8-trifluoroquinoline is Fc1cc(F)c2ncccc2c1F.
What is the InChIKey of 5,6,8-trifluoroquinoline?
The InChIKey is DFYPWUZXTWLPSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3N/c10-6-4-7(11)9-5(8(6)12)2-1-3-13-9/h1-4H.
What are the key properties of 5,6,8-trifluoroquinoline?
5,6,8-trifluoroquinoline has a molecular weight of 183.13 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,8-trifluoroquinoline is sourced from PubChem (CID 3014355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).