C25H29N5O3S — CID 30145042
2-[4-[4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 30145042) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 2-[4-[4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 30145042 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-[4-[4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | Cc1sc2nc(CN3CCN(CCCCN4C(=O)c5ccccc5C4=O)CC3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C25H29N5O3S/c1-16-17(2)34-23-21(16)22(31)26-20(27-23)15-29-13-11-28(12-14-29)9-5-6-10-30-24(32)18-7-3-4-8-19(18)25(30)33/h3-4,7-8H,5-6,9-15H2,1-2H3,(H,26,27,31) |
| InChIKey | NIGUGANRUFTNDY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|