lambda2-plumbane;sulfurous acid

H4O3PbS — CID 3014566

IUPAClambda2-plumbane;sulfurous acid
SMILESO=S(O)O.[PbH2]
InChIInChI=1S/H2O3S.Pb.2H/c1-4(2)3;;;/h(H2,1,2,3);;;
InChIKeyLPVYEHQMLQSUQP-UHFFFAOYSA-N
MW291.30 g/mol
LogP-1.24
Rot. Bonds

About lambda2-plumbane;sulfurous acid

lambda2-plumbane;sulfurous acid (PubChem CID 3014566) has the molecular formula H4O3PbS and a molecular weight of 291.30 g/mol. Its IUPAC name is lambda2-plumbane;sulfurous acid.

Molecular Properties

Compound Namelambda2-plumbane;sulfurous acid
PubChem CID3014566
Molecular FormulaH4O3PbS
Molecular Weight291.30 g/mol
Exact Mass291.96
IUPAC Namelambda2-plumbane;sulfurous acid
SMILESO=S(O)O.[PbH2]
InChIInChI=1S/H2O3S.Pb.2H/c1-4(2)3;;;/h(H2,1,2,3);;;
InChIKeyLPVYEHQMLQSUQP-UHFFFAOYSA-N
XLogP-1.24
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.30
LogP ≤ 5-1.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze lambda2-plumbane;sulfurous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of lambda2-plumbane;sulfurous acid?
The IUPAC name of lambda2-plumbane;sulfurous acid (CID 3014566) is lambda2-plumbane;sulfurous acid.
What is the SMILES notation for lambda2-plumbane;sulfurous acid?
The canonical SMILES for lambda2-plumbane;sulfurous acid is O=S(O)O.[PbH2].
What is the InChIKey of lambda2-plumbane;sulfurous acid?
The InChIKey is LPVYEHQMLQSUQP-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O3S.Pb.2H/c1-4(2)3;;;/h(H2,1,2,3);;;.
What are the key properties of lambda2-plumbane;sulfurous acid?
lambda2-plumbane;sulfurous acid has a molecular weight of 291.30 g/mol, XLogP of -1.24, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lambda2-plumbane;sulfurous acid is sourced from PubChem (CID 3014566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).