About fluoranthen-1-ol
fluoranthen-1-ol (PubChem CID 3014645) has the molecular formula C16H10O
and a molecular weight of 218.25 g/mol. Its IUPAC name is fluoranthen-1-ol.
Molecular Properties
| Compound Name | fluoranthen-1-ol |
| PubChem CID | 3014645 |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | fluoranthen-1-ol |
| SMILES | Oc1ccc2cccc3c2c1-c1ccccc1-3 |
| InChI | InChI=1S/C16H10O/c17-14-9-8-10-4-3-7-12-11-5-1-2-6-13(11)16(14)15(10)12/h1-9,17H |
| InChIKey | CJQDARRYJRAZBV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoranthen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoranthen-1-ol?
The IUPAC name of fluoranthen-1-ol (CID 3014645) is fluoranthen-1-ol.
What is the SMILES notation for fluoranthen-1-ol?
The canonical SMILES for fluoranthen-1-ol is Oc1ccc2cccc3c2c1-c1ccccc1-3.
What is the InChIKey of fluoranthen-1-ol?
The InChIKey is CJQDARRYJRAZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O/c17-14-9-8-10-4-3-7-12-11-5-1-2-6-13(11)16(14)15(10)12/h1-9,17H.
What are the key properties of fluoranthen-1-ol?
fluoranthen-1-ol has a molecular weight of 218.25 g/mol, XLogP of 4.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoranthen-1-ol is sourced from PubChem (CID 3014645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).