About 2-ethenyl-5-methylfuran
2-ethenyl-5-methylfuran (PubChem CID 3014647) has the molecular formula C7H8O
and a molecular weight of 108.14 g/mol. Its IUPAC name is 2-ethenyl-5-methylfuran.
Molecular Properties
| Compound Name | 2-ethenyl-5-methylfuran |
| PubChem CID | 3014647 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | 2-ethenyl-5-methylfuran |
| SMILES | C=Cc1ccc(C)o1 |
| InChI | InChI=1S/C7H8O/c1-3-7-5-4-6(2)8-7/h3-5H,1H2,2H3 |
| InChIKey | LTQOQNQWJBSGPF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-5-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-5-methylfuran?
The IUPAC name of 2-ethenyl-5-methylfuran (CID 3014647) is 2-ethenyl-5-methylfuran.
What is the SMILES notation for 2-ethenyl-5-methylfuran?
The canonical SMILES for 2-ethenyl-5-methylfuran is C=Cc1ccc(C)o1.
What is the InChIKey of 2-ethenyl-5-methylfuran?
The InChIKey is LTQOQNQWJBSGPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O/c1-3-7-5-4-6(2)8-7/h3-5H,1H2,2H3.
What are the key properties of 2-ethenyl-5-methylfuran?
2-ethenyl-5-methylfuran has a molecular weight of 108.14 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-5-methylfuran is sourced from PubChem (CID 3014647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).