C11H10FN3O3 — CID 30147587
4-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-nitroaniline (PubChem CID 30147587) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 4-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-nitroaniline.
| Compound Name | 4-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-nitroaniline |
|---|---|
| PubChem CID | 30147587 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-nitroaniline |
| SMILES | Cc1cc(CNc2ccc(F)c([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C11H10FN3O3/c1-7-4-9(14-18-7)6-13-8-2-3-10(12)11(5-8)15(16)17/h2-5,13H,6H2,1H3 |
| InChIKey | JTLVJCKJMXBWMR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|