C6H2Br5N — CID 3014769
2,3,4,5,6-pentabromoaniline (PubChem CID 3014769) has the molecular formula C6H2Br5N and a molecular weight of 487.61 g/mol. Its IUPAC name is 2,3,4,5,6-pentabromoaniline.
| Compound Name | 2,3,4,5,6-pentabromoaniline |
|---|---|
| PubChem CID | 3014769 |
| Molecular Formula | C6H2Br5N |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 482.61 |
| IUPAC Name | 2,3,4,5,6-pentabromoaniline |
| SMILES | Nc1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C6H2Br5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey | VPFMJGCHDCVATR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|