About copper dichlorate
copper dichlorate (PubChem CID 3014850) has the molecular formula Cl2CuO6
and a molecular weight of 230.45 g/mol. Its IUPAC name is copper dichlorate.
Molecular Properties
| Compound Name | copper dichlorate |
| PubChem CID | 3014850 |
| Molecular Formula | Cl2CuO6 |
| Molecular Weight | 230.45 g/mol |
| Exact Mass | 228.84 |
| IUPAC Name | copper dichlorate |
| SMILES | [Cu+2].[O-][Cl+2]([O-])[O-].[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/2ClO3.Cu/c2*2-1(3)4;/q2*-1;+2 |
| InChIKey | GYCQCSFQJFTLHH-UHFFFAOYSA-N |
| XLogP | -7.14 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.45 |
| LogP ≤ 5 | -7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze copper dichlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper dichlorate?
The IUPAC name of copper dichlorate (CID 3014850) is copper dichlorate.
What is the SMILES notation for copper dichlorate?
The canonical SMILES for copper dichlorate is [Cu+2].[O-][Cl+2]([O-])[O-].[O-][Cl+2]([O-])[O-].
What is the InChIKey of copper dichlorate?
The InChIKey is GYCQCSFQJFTLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClO3.Cu/c2*2-1(3)4;/q2*-1;+2.
What are the key properties of copper dichlorate?
copper dichlorate has a molecular weight of 230.45 g/mol, XLogP of -7.14, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper dichlorate is sourced from PubChem (CID 3014850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).