About 2-isocyanatoanthracene
2-isocyanatoanthracene (PubChem CID 3014959) has the molecular formula C15H9NO
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-isocyanatoanthracene.
Molecular Properties
| Compound Name | 2-isocyanatoanthracene |
| PubChem CID | 3014959 |
| Molecular Formula | C15H9NO |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-isocyanatoanthracene |
| SMILES | O=C=Nc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C15H9NO/c17-10-16-15-6-5-13-7-11-3-1-2-4-12(11)8-14(13)9-15/h1-9H |
| InChIKey | BAPCPEHKRFAZAL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatoanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatoanthracene?
The IUPAC name of 2-isocyanatoanthracene (CID 3014959) is 2-isocyanatoanthracene.
What is the SMILES notation for 2-isocyanatoanthracene?
The canonical SMILES for 2-isocyanatoanthracene is O=C=Nc1ccc2cc3ccccc3cc2c1.
What is the InChIKey of 2-isocyanatoanthracene?
The InChIKey is BAPCPEHKRFAZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NO/c17-10-16-15-6-5-13-7-11-3-1-2-4-12(11)8-14(13)9-15/h1-9H.
What are the key properties of 2-isocyanatoanthracene?
2-isocyanatoanthracene has a molecular weight of 219.24 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatoanthracene is sourced from PubChem (CID 3014959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).