About disodium;pyridine-2,6-dicarboxylate
disodium;pyridine-2,6-dicarboxylate (PubChem CID 3015002) has the molecular formula C7H3NNa2O4
and a molecular weight of 211.08 g/mol. Its IUPAC name is disodium;pyridine-2,6-dicarboxylate.
Molecular Properties
| Compound Name | disodium;pyridine-2,6-dicarboxylate |
| PubChem CID | 3015002 |
| Molecular Formula | C7H3NNa2O4 |
| Molecular Weight | 211.08 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | disodium;pyridine-2,6-dicarboxylate |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])n1.[Na+].[Na+] |
| InChI | InChI=1S/C7H5NO4.2Na/c9-6(10)4-2-1-3-5(8-4)7(11)12;;/h1-3H,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | UXIGLKSQMPZUGZ-UHFFFAOYSA-L |
| XLogP | -8.18 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.08 |
| LogP ≤ 5 | -8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;pyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;pyridine-2,6-dicarboxylate?
The IUPAC name of disodium;pyridine-2,6-dicarboxylate (CID 3015002) is disodium;pyridine-2,6-dicarboxylate.
What is the SMILES notation for disodium;pyridine-2,6-dicarboxylate?
The canonical SMILES for disodium;pyridine-2,6-dicarboxylate is O=C([O-])c1cccc(C(=O)[O-])n1.[Na+].[Na+].
What is the InChIKey of disodium;pyridine-2,6-dicarboxylate?
The InChIKey is UXIGLKSQMPZUGZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H5NO4.2Na/c9-6(10)4-2-1-3-5(8-4)7(11)12;;/h1-3H,(H,9,10)(H,11,12);;/q;2*+1/p-2.
What are the key properties of disodium;pyridine-2,6-dicarboxylate?
disodium;pyridine-2,6-dicarboxylate has a molecular weight of 211.08 g/mol, XLogP of -8.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;pyridine-2,6-dicarboxylate is sourced from PubChem (CID 3015002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).