About dibenzofuran-4-ol
dibenzofuran-4-ol (PubChem CID 3015051) has the molecular formula C12H8O2
and a molecular weight of 184.19 g/mol. Its IUPAC name is dibenzofuran-4-ol.
Molecular Properties
| Compound Name | dibenzofuran-4-ol |
| PubChem CID | 3015051 |
| Molecular Formula | C12H8O2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | dibenzofuran-4-ol |
| SMILES | Oc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C12H8O2/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,13H |
| InChIKey | ZYGJIKIEQYYOKG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibenzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-4-ol?
The IUPAC name of dibenzofuran-4-ol (CID 3015051) is dibenzofuran-4-ol.
What is the SMILES notation for dibenzofuran-4-ol?
The canonical SMILES for dibenzofuran-4-ol is Oc1cccc2c1oc1ccccc12.
What is the InChIKey of dibenzofuran-4-ol?
The InChIKey is ZYGJIKIEQYYOKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,13H.
What are the key properties of dibenzofuran-4-ol?
dibenzofuran-4-ol has a molecular weight of 184.19 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-4-ol is sourced from PubChem (CID 3015051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).