C20H25ClN2O6S — CID 30151398
2-[(4-chlorophenyl)methyl-methylsulfonylamino]-4,5-dimethoxy-N-(2-methoxyethyl)benzamide (PubChem CID 30151398) has the molecular formula C20H25ClN2O6S and a molecular weight of 456.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-methylsulfonylamino]-4,5-dimethoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-methylsulfonylamino]-4,5-dimethoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 30151398 |
| Molecular Formula | C20H25ClN2O6S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-methylsulfonylamino]-4,5-dimethoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cc(OC)c(OC)cc1N(Cc1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H25ClN2O6S/c1-27-10-9-22-20(24)16-11-18(28-2)19(29-3)12-17(16)23(30(4,25)26)13-14-5-7-15(21)8-6-14/h5-8,11-12H,9-10,13H2,1-4H3,(H,22,24) |
| InChIKey | NSWZZJZZCBDKHO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|