C15H25N3O5S — CID 3015144
methanesulfonate;(6-methyl-7-nitro-1,2,3,4-tetrahydroquinolin-2-yl)methyl-propan-2-ylazanium (PubChem CID 3015144) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is methanesulfonate;(6-methyl-7-nitro-1,2,3,4-tetrahydroquinolin-2-yl)methyl-propan-2-ylazanium.
| Compound Name | methanesulfonate;(6-methyl-7-nitro-1,2,3,4-tetrahydroquinolin-2-yl)methyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 3015144 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | methanesulfonate;(6-methyl-7-nitro-1,2,3,4-tetrahydroquinolin-2-yl)methyl-propan-2-ylazanium |
| SMILES | CS(=O)(=O)[O-].Cc1cc2c(cc1[N+](=O)[O-])NC(C[NH2+]C(C)C)CC2 |
| InChI | InChI=1S/C14H21N3O2.CH4O3S/c1-9(2)15-8-12-5-4-11-6-10(3)14(17(18)19)7-13(11)16-12;1-5(2,3)4/h6-7,9,12,15-16H,4-5,8H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | CPELYVXNHLDWEC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|