About 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine
4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine (PubChem CID 3015176) has the molecular formula C33H23N3
and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine.
Molecular Properties
| Compound Name | 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine |
| PubChem CID | 3015176 |
| Molecular Formula | C33H23N3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine |
| SMILES | c1ccc(-c2ccnc(-c3cc(-c4ccccc4)cc(-c4cc(-c5ccccc5)ccn4)n3)c2)cc1 |
| InChI | InChI=1S/C33H23N3/c1-4-10-24(11-5-1)27-16-18-34-30(20-27)32-22-29(26-14-8-3-9-15-26)23-33(36-32)31-21-28(17-19-35-31)25-12-6-2-7-13-25/h1-23H |
| InChIKey | VDJNDMHRAOTPKU-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine?
The IUPAC name of 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine (CID 3015176) is 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine.
What is the SMILES notation for 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine?
The canonical SMILES for 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine is c1ccc(-c2ccnc(-c3cc(-c4ccccc4)cc(-c4cc(-c5ccccc5)ccn4)n3)c2)cc1.
What is the InChIKey of 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine?
The InChIKey is VDJNDMHRAOTPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H23N3/c1-4-10-24(11-5-1)27-16-18-34-30(20-27)32-22-29(26-14-8-3-9-15-26)23-33(36-32)31-21-28(17-19-35-31)25-12-6-2-7-13-25/h1-23H.
What are the key properties of 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine?
4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine has a molecular weight of 461.57 g/mol, XLogP of 8.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2,6-bis(4-phenyl-2-pyridinyl)pyridine is sourced from PubChem (CID 3015176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).