About 5-chloroquinolin-8-ol;hydrochloride
5-chloroquinolin-8-ol;hydrochloride (PubChem CID 3015226) has the molecular formula C9H7Cl2NO
and a molecular weight of 216.07 g/mol. Its IUPAC name is 5-chloroquinolin-8-ol;hydrochloride.
Molecular Properties
| Compound Name | 5-chloroquinolin-8-ol;hydrochloride |
| PubChem CID | 3015226 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 5-chloroquinolin-8-ol;hydrochloride |
| SMILES | Cl.Oc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C9H6ClNO.ClH/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;/h1-5,12H;1H |
| InChIKey | QKWIORGVGGOEFG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloroquinolin-8-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloroquinolin-8-ol;hydrochloride?
The IUPAC name of 5-chloroquinolin-8-ol;hydrochloride (CID 3015226) is 5-chloroquinolin-8-ol;hydrochloride.
What is the SMILES notation for 5-chloroquinolin-8-ol;hydrochloride?
The canonical SMILES for 5-chloroquinolin-8-ol;hydrochloride is Cl.Oc1ccc(Cl)c2cccnc12.
What is the InChIKey of 5-chloroquinolin-8-ol;hydrochloride?
The InChIKey is QKWIORGVGGOEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO.ClH/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;/h1-5,12H;1H.
What are the key properties of 5-chloroquinolin-8-ol;hydrochloride?
5-chloroquinolin-8-ol;hydrochloride has a molecular weight of 216.07 g/mol, XLogP of 3.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloroquinolin-8-ol;hydrochloride is sourced from PubChem (CID 3015226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).