C18H15F3N2OS — CID 30152590
N-(2-propyl-1,3-benzothiazol-6-yl)-3-(trifluoromethyl)benzamide (PubChem CID 30152590) has the molecular formula C18H15F3N2OS and a molecular weight of 364.39 g/mol. Its IUPAC name is N-(2-propyl-1,3-benzothiazol-6-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-propyl-1,3-benzothiazol-6-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 30152590 |
| Molecular Formula | C18H15F3N2OS |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(2-propyl-1,3-benzothiazol-6-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CCCc1nc2ccc(NC(=O)c3cccc(C(F)(F)F)c3)cc2s1 |
| InChI | InChI=1S/C18H15F3N2OS/c1-2-4-16-23-14-8-7-13(10-15(14)25-16)22-17(24)11-5-3-6-12(9-11)18(19,20)21/h3,5-10H,2,4H2,1H3,(H,22,24) |
| InChIKey | AQMUTUSJTSQNLH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |