C11H11N3 — CID 3015331
2-N-phenylpyridine-2,5-diamine (PubChem CID 3015331) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-N-phenylpyridine-2,5-diamine.
| Compound Name | 2-N-phenylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 3015331 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-N-phenylpyridine-2,5-diamine |
| SMILES | Nc1ccc(Nc2ccccc2)nc1 |
| InChI | InChI=1S/C11H11N3/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H,12H2,(H,13,14) |
| InChIKey | NDNQUJQOJSNZGA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_no_alk_A(1)', 'substructure': 'N/A'} |
|---|