C12H7F2NO3 — CID 3015409
2,4-difluoro-1-(4-nitrophenoxy)benzene (PubChem CID 3015409) has the molecular formula C12H7F2NO3 and a molecular weight of 251.19 g/mol. Its IUPAC name is 2,4-difluoro-1-(4-nitrophenoxy)benzene.
| Compound Name | 2,4-difluoro-1-(4-nitrophenoxy)benzene |
|---|---|
| PubChem CID | 3015409 |
| Molecular Formula | C12H7F2NO3 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2,4-difluoro-1-(4-nitrophenoxy)benzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C12H7F2NO3/c13-8-1-6-12(11(14)7-8)18-10-4-2-9(3-5-10)15(16)17/h1-7H |
| InChIKey | BEVUWKGENAGXJN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|