About 1,2-dimethylthianthrene
1,2-dimethylthianthrene (PubChem CID 3015465) has the molecular formula C14H12S2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 1,2-dimethylthianthrene.
Molecular Properties
| Compound Name | 1,2-dimethylthianthrene |
| PubChem CID | 3015465 |
| Molecular Formula | C14H12S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1,2-dimethylthianthrene |
| SMILES | Cc1ccc2c(c1C)Sc1ccccc1S2 |
| InChI | InChI=1S/C14H12S2/c1-9-7-8-13-14(10(9)2)16-12-6-4-3-5-11(12)15-13/h3-8H,1-2H3 |
| InChIKey | XWTUFPFWNHRJNF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethylthianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylthianthrene?
The IUPAC name of 1,2-dimethylthianthrene (CID 3015465) is 1,2-dimethylthianthrene.
What is the SMILES notation for 1,2-dimethylthianthrene?
The canonical SMILES for 1,2-dimethylthianthrene is Cc1ccc2c(c1C)Sc1ccccc1S2.
What is the InChIKey of 1,2-dimethylthianthrene?
The InChIKey is XWTUFPFWNHRJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12S2/c1-9-7-8-13-14(10(9)2)16-12-6-4-3-5-11(12)15-13/h3-8H,1-2H3.
What are the key properties of 1,2-dimethylthianthrene?
1,2-dimethylthianthrene has a molecular weight of 244.38 g/mol, XLogP of 4.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylthianthrene is sourced from PubChem (CID 3015465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).