About cyclododecane-1,1-diol
cyclododecane-1,1-diol (PubChem CID 3015489) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is cyclododecane-1,1-diol.
Molecular Properties
| Compound Name | cyclododecane-1,1-diol |
| PubChem CID | 3015489 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | cyclododecane-1,1-diol |
| SMILES | OC1(O)CCCCCCCCCCC1 |
| InChI | InChI=1S/C12H24O2/c13-12(14)10-8-6-4-2-1-3-5-7-9-11-12/h13-14H,1-11H2 |
| InChIKey | MGBBJDOYTDFYHH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclododecane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclododecane-1,1-diol?
The IUPAC name of cyclododecane-1,1-diol (CID 3015489) is cyclododecane-1,1-diol.
What is the SMILES notation for cyclododecane-1,1-diol?
The canonical SMILES for cyclododecane-1,1-diol is OC1(O)CCCCCCCCCCC1.
What is the InChIKey of cyclododecane-1,1-diol?
The InChIKey is MGBBJDOYTDFYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c13-12(14)10-8-6-4-2-1-3-5-7-9-11-12/h13-14H,1-11H2.
What are the key properties of cyclododecane-1,1-diol?
cyclododecane-1,1-diol has a molecular weight of 200.32 g/mol, XLogP of 2.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclododecane-1,1-diol is sourced from PubChem (CID 3015489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).