C8H16N2O — CID 3015520
1,3,5,5-tetramethyl-1,3-diazinan-2-one (PubChem CID 3015520) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,3,5,5-tetramethyl-1,3-diazinan-2-one.
| Compound Name | 1,3,5,5-tetramethyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 3015520 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1,3,5,5-tetramethyl-1,3-diazinan-2-one |
| SMILES | CN1CC(C)(C)CN(C)C1=O |
| InChI | InChI=1S/C8H16N2O/c1-8(2)5-9(3)7(11)10(4)6-8/h5-6H2,1-4H3 |
| InChIKey | OTEZPAVCBPPFLU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |