About 3,7-dihydropurine-2-thione
3,7-dihydropurine-2-thione (PubChem CID 3015569) has the molecular formula C5H4N4S
and a molecular weight of 152.18 g/mol. Its IUPAC name is 3,7-dihydropurine-2-thione.
Molecular Properties
| Compound Name | 3,7-dihydropurine-2-thione |
| PubChem CID | 3015569 |
| Molecular Formula | C5H4N4S |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 3,7-dihydropurine-2-thione |
| SMILES | S=c1ncc2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H4N4S/c10-5-6-1-3-4(9-5)8-2-7-3/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | HDBQZGJWHMCXIL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dihydropurine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydropurine-2-thione?
The IUPAC name of 3,7-dihydropurine-2-thione (CID 3015569) is 3,7-dihydropurine-2-thione.
What is the SMILES notation for 3,7-dihydropurine-2-thione?
The canonical SMILES for 3,7-dihydropurine-2-thione is S=c1ncc2[nH]cnc2[nH]1.
What is the InChIKey of 3,7-dihydropurine-2-thione?
The InChIKey is HDBQZGJWHMCXIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4S/c10-5-6-1-3-4(9-5)8-2-7-3/h1-2H,(H2,6,7,8,9,10).
What are the key properties of 3,7-dihydropurine-2-thione?
3,7-dihydropurine-2-thione has a molecular weight of 152.18 g/mol, XLogP of 1.02, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydropurine-2-thione is sourced from PubChem (CID 3015569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).