About 2-ethyl-N,N-dimethylbutanamide
2-ethyl-N,N-dimethylbutanamide (PubChem CID 3015572) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-ethyl-N,N-dimethylbutanamide |
| PubChem CID | 3015572 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-ethyl-N,N-dimethylbutanamide |
| SMILES | CCC(CC)C(=O)N(C)C |
| InChI | InChI=1S/C8H17NO/c1-5-7(6-2)8(10)9(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | GBSXCHLYXIBMCZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-dimethylbutanamide?
The IUPAC name of 2-ethyl-N,N-dimethylbutanamide (CID 3015572) is 2-ethyl-N,N-dimethylbutanamide.
What is the SMILES notation for 2-ethyl-N,N-dimethylbutanamide?
The canonical SMILES for 2-ethyl-N,N-dimethylbutanamide is CCC(CC)C(=O)N(C)C.
What is the InChIKey of 2-ethyl-N,N-dimethylbutanamide?
The InChIKey is GBSXCHLYXIBMCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-5-7(6-2)8(10)9(3)4/h7H,5-6H2,1-4H3.
What are the key properties of 2-ethyl-N,N-dimethylbutanamide?
2-ethyl-N,N-dimethylbutanamide has a molecular weight of 143.23 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-dimethylbutanamide is sourced from PubChem (CID 3015572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).