C12H10BrNO3 — CID 3015591
(3,4-dihydroxyphenyl)-pyridin-2-ylmethanone;hydrobromide (PubChem CID 3015591) has the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-pyridin-2-ylmethanone;hydrobromide.
| Compound Name | (3,4-dihydroxyphenyl)-pyridin-2-ylmethanone;hydrobromide |
|---|---|
| PubChem CID | 3015591 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | (3,4-dihydroxyphenyl)-pyridin-2-ylmethanone;hydrobromide |
| SMILES | Br.O=C(c1ccc(O)c(O)c1)c1ccccn1 |
| InChI | InChI=1S/C12H9NO3.BrH/c14-10-5-4-8(7-11(10)15)12(16)9-3-1-2-6-13-9;/h1-7,14-15H;1H |
| InChIKey | KTDLKYUKPICNPE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|