About 1-methoxyethanol
1-methoxyethanol (PubChem CID 3015637) has the molecular formula C3H8O2
and a molecular weight of 76.09 g/mol. Its IUPAC name is 1-methoxyethanol.
Molecular Properties
| Compound Name | 1-methoxyethanol |
| PubChem CID | 3015637 |
| Molecular Formula | C3H8O2 |
| Molecular Weight | 76.09 g/mol |
| Exact Mass | 76.05 |
| IUPAC Name | 1-methoxyethanol |
| SMILES | COC(C)O |
| InChI | InChI=1S/C3H8O2/c1-3(4)5-2/h3-4H,1-2H3 |
| InChIKey | GEGLCBTXYBXOJA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.09 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethanol?
The IUPAC name of 1-methoxyethanol (CID 3015637) is 1-methoxyethanol.
What is the SMILES notation for 1-methoxyethanol?
The canonical SMILES for 1-methoxyethanol is COC(C)O.
What is the InChIKey of 1-methoxyethanol?
The InChIKey is GEGLCBTXYBXOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2/c1-3(4)5-2/h3-4H,1-2H3.
What are the key properties of 1-methoxyethanol?
1-methoxyethanol has a molecular weight of 76.09 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethanol is sourced from PubChem (CID 3015637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).