C22H32N2O3 — CID 3015680
1,3-dicyclohexyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione (PubChem CID 3015680) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dicyclohexyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3015680 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1,3-dicyclohexyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(CC=C)C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C22H32N2O3/c1-3-15-22(16-4-2)19(25)23(17-11-7-5-8-12-17)21(27)24(20(22)26)18-13-9-6-10-14-18/h3-4,17-18H,1-2,5-16H2 |
| InChIKey | WPXAGRCFPLBOHP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|