C30H35N3O3S — CID 30156942
(4-benzhydrylpiperazin-1-yl)-[(3S)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanone (PubChem CID 30156942) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[(3S)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[(3S)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 30156942 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[(3S)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)C2)cc1 |
| InChI | InChI=1S/C30H35N3O3S/c1-24-14-16-28(17-15-24)37(35,36)33-18-8-13-27(23-33)30(34)32-21-19-31(20-22-32)29(25-9-4-2-5-10-25)26-11-6-3-7-12-26/h2-7,9-12,14-17,27,29H,8,13,18-23H2,1H3/t27-/m0/s1 |
| InChIKey | CHZOVRBDOJUEJY-MHZLTWQESA-N |
| XLogP | 4.33 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |