About 4-fluoro-N,N,2-trimethylaniline
4-fluoro-N,N,2-trimethylaniline (PubChem CID 3015738) has the molecular formula C9H12FN
and a molecular weight of 153.20 g/mol. Its IUPAC name is 4-fluoro-N,N,2-trimethylaniline.
Molecular Properties
| Compound Name | 4-fluoro-N,N,2-trimethylaniline |
| PubChem CID | 3015738 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 4-fluoro-N,N,2-trimethylaniline |
| SMILES | Cc1cc(F)ccc1N(C)C |
| InChI | InChI=1S/C9H12FN/c1-7-6-8(10)4-5-9(7)11(2)3/h4-6H,1-3H3 |
| InChIKey | XCGOAKAAORSAPJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N,N,2-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,N,2-trimethylaniline?
The IUPAC name of 4-fluoro-N,N,2-trimethylaniline (CID 3015738) is 4-fluoro-N,N,2-trimethylaniline.
What is the SMILES notation for 4-fluoro-N,N,2-trimethylaniline?
The canonical SMILES for 4-fluoro-N,N,2-trimethylaniline is Cc1cc(F)ccc1N(C)C.
What is the InChIKey of 4-fluoro-N,N,2-trimethylaniline?
The InChIKey is XCGOAKAAORSAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN/c1-7-6-8(10)4-5-9(7)11(2)3/h4-6H,1-3H3.
What are the key properties of 4-fluoro-N,N,2-trimethylaniline?
4-fluoro-N,N,2-trimethylaniline has a molecular weight of 153.20 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,N,2-trimethylaniline is sourced from PubChem (CID 3015738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).