About 2-pyridin-2-yloxyphenol
2-pyridin-2-yloxyphenol (PubChem CID 3015826) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-pyridin-2-yloxyphenol.
Molecular Properties
| Compound Name | 2-pyridin-2-yloxyphenol |
| PubChem CID | 3015826 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 2-pyridin-2-yloxyphenol |
| SMILES | Oc1ccccc1Oc1ccccn1 |
| InChI | InChI=1S/C11H9NO2/c13-9-5-1-2-6-10(9)14-11-7-3-4-8-12-11/h1-8,13H |
| InChIKey | XWBHCJMXMDVYLP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-2-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yloxyphenol?
The IUPAC name of 2-pyridin-2-yloxyphenol (CID 3015826) is 2-pyridin-2-yloxyphenol.
What is the SMILES notation for 2-pyridin-2-yloxyphenol?
The canonical SMILES for 2-pyridin-2-yloxyphenol is Oc1ccccc1Oc1ccccn1.
What is the InChIKey of 2-pyridin-2-yloxyphenol?
The InChIKey is XWBHCJMXMDVYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-9-5-1-2-6-10(9)14-11-7-3-4-8-12-11/h1-8,13H.
What are the key properties of 2-pyridin-2-yloxyphenol?
2-pyridin-2-yloxyphenol has a molecular weight of 187.20 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yloxyphenol is sourced from PubChem (CID 3015826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).