methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate

C10H14O4 — CID 3015856

IUPACmethyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate
SMILESCOC(=O)C1C(O)=C(C)C(=O)CC1C
InChIInChI=1S/C10H14O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h5,8,12H,4H2,1-3H3
InChIKeyGRUZVKBJCPADAL-UHFFFAOYSA-N
MW198.22 g/mol
LogP1.22
Rot. Bonds1

About methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate

methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 3015856) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate
PubChem CID3015856
Molecular FormulaC10H14O4
Molecular Weight198.22 g/mol
Exact Mass198.09
IUPAC Namemethyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate
SMILESCOC(=O)C1C(O)=C(C)C(=O)CC1C
InChIInChI=1S/C10H14O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h5,8,12H,4H2,1-3H3
InChIKeyGRUZVKBJCPADAL-UHFFFAOYSA-N
XLogP1.22
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate (CID 3015856) is methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate is COC(=O)C1C(O)=C(C)C(=O)CC1C.
What is the InChIKey of methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
The InChIKey is GRUZVKBJCPADAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h5,8,12H,4H2,1-3H3.
What are the key properties of methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 3015856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).