About 4,4-diphenylbutan-1-amine
4,4-diphenylbutan-1-amine (PubChem CID 3015863) has the molecular formula C16H19N
and a molecular weight of 225.34 g/mol. Its IUPAC name is 4,4-diphenylbutan-1-amine.
Molecular Properties
| Compound Name | 4,4-diphenylbutan-1-amine |
| PubChem CID | 3015863 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4,4-diphenylbutan-1-amine |
| SMILES | NCCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13,17H2 |
| InChIKey | MAAQGZFMFXQVOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-diphenylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenylbutan-1-amine?
The IUPAC name of 4,4-diphenylbutan-1-amine (CID 3015863) is 4,4-diphenylbutan-1-amine.
What is the SMILES notation for 4,4-diphenylbutan-1-amine?
The canonical SMILES for 4,4-diphenylbutan-1-amine is NCCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of 4,4-diphenylbutan-1-amine?
The InChIKey is MAAQGZFMFXQVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13,17H2.
What are the key properties of 4,4-diphenylbutan-1-amine?
4,4-diphenylbutan-1-amine has a molecular weight of 225.34 g/mol, XLogP of 3.56, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenylbutan-1-amine is sourced from PubChem (CID 3015863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).