About 2-(bromomethyl)-1,3-dichlorobenzene
2-(bromomethyl)-1,3-dichlorobenzene (PubChem CID 30159) has the molecular formula C7H5BrCl2
and a molecular weight of 239.93 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-dichlorobenzene.
Molecular Properties
| Compound Name | 2-(bromomethyl)-1,3-dichlorobenzene |
| PubChem CID | 30159 |
| Molecular Formula | C7H5BrCl2 |
| Molecular Weight | 239.93 g/mol |
| Exact Mass | 237.90 |
| IUPAC Name | 2-(bromomethyl)-1,3-dichlorobenzene |
| SMILES | Clc1cccc(Cl)c1CBr |
| InChI | InChI=1S/C7H5BrCl2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | PDFGFQUSSYSWNI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.93 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-1,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-1,3-dichlorobenzene?
The IUPAC name of 2-(bromomethyl)-1,3-dichlorobenzene (CID 30159) is 2-(bromomethyl)-1,3-dichlorobenzene.
What is the SMILES notation for 2-(bromomethyl)-1,3-dichlorobenzene?
The canonical SMILES for 2-(bromomethyl)-1,3-dichlorobenzene is Clc1cccc(Cl)c1CBr.
What is the InChIKey of 2-(bromomethyl)-1,3-dichlorobenzene?
The InChIKey is PDFGFQUSSYSWNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrCl2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2.
What are the key properties of 2-(bromomethyl)-1,3-dichlorobenzene?
2-(bromomethyl)-1,3-dichlorobenzene has a molecular weight of 239.93 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-1,3-dichlorobenzene is sourced from PubChem (CID 30159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).