About 3-phenylbutan-1-amine
3-phenylbutan-1-amine (PubChem CID 3015962) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-phenylbutan-1-amine.
Molecular Properties
| Compound Name | 3-phenylbutan-1-amine |
| PubChem CID | 3015962 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3-phenylbutan-1-amine |
| SMILES | CC(CCN)c1ccccc1 |
| InChI | InChI=1S/C10H15N/c1-9(7-8-11)10-5-3-2-4-6-10/h2-6,9H,7-8,11H2,1H3 |
| InChIKey | HJMCIHLESAJJQL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbutan-1-amine?
The IUPAC name of 3-phenylbutan-1-amine (CID 3015962) is 3-phenylbutan-1-amine.
What is the SMILES notation for 3-phenylbutan-1-amine?
The canonical SMILES for 3-phenylbutan-1-amine is CC(CCN)c1ccccc1.
What is the InChIKey of 3-phenylbutan-1-amine?
The InChIKey is HJMCIHLESAJJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-9(7-8-11)10-5-3-2-4-6-10/h2-6,9H,7-8,11H2,1H3.
What are the key properties of 3-phenylbutan-1-amine?
3-phenylbutan-1-amine has a molecular weight of 149.24 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbutan-1-amine is sourced from PubChem (CID 3015962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).