C13H19NO — CID 3016056
3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,2-oxazole (PubChem CID 3016056) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 3016056 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,2-oxazole |
| SMILES | CC1=CCCC(C)(C)C1c1cc(C)no1 |
| InChI | InChI=1S/C13H19NO/c1-9-6-5-7-13(3,4)12(9)11-8-10(2)14-15-11/h6,8,12H,5,7H2,1-4H3 |
| InChIKey | UEBXVANRKDLJNF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|