About 4,4-dimethoxybutan-2-ol
4,4-dimethoxybutan-2-ol (PubChem CID 3016088) has the molecular formula C6H14O3
and a molecular weight of 134.17 g/mol. Its IUPAC name is 4,4-dimethoxybutan-2-ol.
Molecular Properties
| Compound Name | 4,4-dimethoxybutan-2-ol |
| PubChem CID | 3016088 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 4,4-dimethoxybutan-2-ol |
| SMILES | COC(CC(C)O)OC |
| InChI | InChI=1S/C6H14O3/c1-5(7)4-6(8-2)9-3/h5-7H,4H2,1-3H3 |
| InChIKey | QBOIGWDDFIREJQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethoxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethoxybutan-2-ol?
The IUPAC name of 4,4-dimethoxybutan-2-ol (CID 3016088) is 4,4-dimethoxybutan-2-ol.
What is the SMILES notation for 4,4-dimethoxybutan-2-ol?
The canonical SMILES for 4,4-dimethoxybutan-2-ol is COC(CC(C)O)OC.
What is the InChIKey of 4,4-dimethoxybutan-2-ol?
The InChIKey is QBOIGWDDFIREJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3/c1-5(7)4-6(8-2)9-3/h5-7H,4H2,1-3H3.
What are the key properties of 4,4-dimethoxybutan-2-ol?
4,4-dimethoxybutan-2-ol has a molecular weight of 134.17 g/mol, XLogP of 0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethoxybutan-2-ol is sourced from PubChem (CID 3016088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).