About 2-bromo-N,N-dibutylacetamide
2-bromo-N,N-dibutylacetamide (PubChem CID 3016161) has the molecular formula C10H20BrNO
and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-bromo-N,N-dibutylacetamide.
Molecular Properties
| Compound Name | 2-bromo-N,N-dibutylacetamide |
| PubChem CID | 3016161 |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-bromo-N,N-dibutylacetamide |
| SMILES | CCCCN(CCCC)C(=O)CBr |
| InChI | InChI=1S/C10H20BrNO/c1-3-5-7-12(8-6-4-2)10(13)9-11/h3-9H2,1-2H3 |
| InChIKey | UQISDSAIAARTPX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-dibutylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-dibutylacetamide?
The IUPAC name of 2-bromo-N,N-dibutylacetamide (CID 3016161) is 2-bromo-N,N-dibutylacetamide.
What is the SMILES notation for 2-bromo-N,N-dibutylacetamide?
The canonical SMILES for 2-bromo-N,N-dibutylacetamide is CCCCN(CCCC)C(=O)CBr.
What is the InChIKey of 2-bromo-N,N-dibutylacetamide?
The InChIKey is UQISDSAIAARTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrNO/c1-3-5-7-12(8-6-4-2)10(13)9-11/h3-9H2,1-2H3.
What are the key properties of 2-bromo-N,N-dibutylacetamide?
2-bromo-N,N-dibutylacetamide has a molecular weight of 250.18 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-dibutylacetamide is sourced from PubChem (CID 3016161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).