C20H18ClN3O5S — CID 30161951
4-chloro-3-[(4-ethoxyphenyl)sulfamoyl]-N-(3-hydroxy-2-pyridinyl)benzamide (PubChem CID 30161951) has the molecular formula C20H18ClN3O5S and a molecular weight of 447.90 g/mol. Its IUPAC name is 4-chloro-3-[(4-ethoxyphenyl)sulfamoyl]-N-(3-hydroxy-2-pyridinyl)benzamide.
| Compound Name | 4-chloro-3-[(4-ethoxyphenyl)sulfamoyl]-N-(3-hydroxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 30161951 |
| Molecular Formula | C20H18ClN3O5S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 4-chloro-3-[(4-ethoxyphenyl)sulfamoyl]-N-(3-hydroxy-2-pyridinyl)benzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(C(=O)Nc3ncccc3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O5S/c1-2-29-15-8-6-14(7-9-15)24-30(27,28)18-12-13(5-10-16(18)21)20(26)23-19-17(25)4-3-11-22-19/h3-12,24-25H,2H2,1H3,(H,22,23,26) |
| InChIKey | KIFQLQWOXNUWKV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |