1-hydroxy-2,2-dimethylpropane-1-sulfonic acid

C5H12O4S — CID 3016429

IUPAC1-hydroxy-2,2-dimethylpropane-1-sulfonic acid
SMILESCC(C)(C)C(O)S(=O)(=O)O
InChIInChI=1S/C5H12O4S/c1-5(2,3)4(6)10(7,8)9/h4,6H,1-3H3,(H,7,8,9)
InChIKeyORIIVMJFMLLZLL-UHFFFAOYSA-N
MW168.21 g/mol
LogP0.24
Rot. Bonds1

About 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid

1-hydroxy-2,2-dimethylpropane-1-sulfonic acid (PubChem CID 3016429) has the molecular formula C5H12O4S and a molecular weight of 168.21 g/mol. Its IUPAC name is 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid.

Molecular Properties

Compound Name1-hydroxy-2,2-dimethylpropane-1-sulfonic acid
PubChem CID3016429
Molecular FormulaC5H12O4S
Molecular Weight168.21 g/mol
Exact Mass168.05
IUPAC Name1-hydroxy-2,2-dimethylpropane-1-sulfonic acid
SMILESCC(C)(C)C(O)S(=O)(=O)O
InChIInChI=1S/C5H12O4S/c1-5(2,3)4(6)10(7,8)9/h4,6H,1-3H3,(H,7,8,9)
InChIKeyORIIVMJFMLLZLL-UHFFFAOYSA-N
XLogP0.24
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.21
LogP ≤ 50.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid?
The IUPAC name of 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid (CID 3016429) is 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid.
What is the SMILES notation for 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid?
The canonical SMILES for 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid is CC(C)(C)C(O)S(=O)(=O)O.
What is the InChIKey of 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid?
The InChIKey is ORIIVMJFMLLZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O4S/c1-5(2,3)4(6)10(7,8)9/h4,6H,1-3H3,(H,7,8,9).
What are the key properties of 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid?
1-hydroxy-2,2-dimethylpropane-1-sulfonic acid has a molecular weight of 168.21 g/mol, XLogP of 0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,2-dimethylpropane-1-sulfonic acid is sourced from PubChem (CID 3016429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).